CAS 918865-07-3

2-(4-Morpholinylsulfonyl)benzenemethanamine

Description:

2-(4-Morpholinylsulfonyl)benzenemethanamine, identified by its CAS number 918865-07-3, is a chemical compound characterized by its unique structural features. It contains a benzenemethanamine core substituted with a morpholinylsulfonyl group, which contributes to its potential biological activity. The morpholine ring, a six-membered heterocycle containing oxygen and nitrogen, enhances the compound's solubility and interaction with biological targets. This compound may exhibit properties such as being a potential pharmacological agent, given its structural motifs that are often associated with various therapeutic effects. The sulfonyl group can influence the compound's reactivity and stability, making it suitable for various chemical reactions. Additionally, the presence of amine functionality suggests potential for hydrogen bonding and interaction with biological macromolecules. Overall, 2-(4-Morpholinylsulfonyl)benzenemethanamine is of interest in medicinal chemistry and drug development, although specific biological activities and applications would require further investigation through experimental studies.

Formula: C₁₁H₁₆N₂O₃S

InChI: InChI=1S/C11H16N2O3S/c12-9-10-3-1-2-4-11(10)17(14,15)13-5-7-16-8-6-13/h1-4H,5-9,12H2

InChI key: InChIKey=WUDANWFUBVLOQS-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=C(CN)C=CC=C1)N2CCOCC2

Synonyms:

• Benzenemethanamine, 2-(4-morpholinylsulfonyl)-
• 2-(4-Morpholinylsulfonyl)benzenemethanamine
• [2-(Morpholine-4-sulfonyl)phenyl]methanamine

[2-(Morpholine-4-sulfonyl)phenyl]methanamine

CAS: 918865-07-3

Versatile small molecule scaffold

Formula: C₁₁H₁₆N₂O₃S

Purity: Min. 95%

Molecular weight: 256.32 g/mol

Ref: 3D-TLB86507