CAS 91889-35-9
:2,2-dideuterio-1-(4-methoxyphenyl)propan-1-one
Description:
2,2-Dideuterio-1-(4-methoxyphenyl)propan-1-one is a deuterated compound, which means it contains two deuterium atoms, a stable isotope of hydrogen. This compound features a propanone structure with a methoxyphenyl group, indicating the presence of a methoxy (-OCH3) substituent attached to a phenyl ring at the 4-position. The deuterium substitution can influence the compound's physical and chemical properties, such as its boiling point, solubility, and reactivity, compared to its non-deuterated counterpart. Deuterated compounds are often used in NMR spectroscopy and other analytical techniques due to their unique spectral characteristics. The presence of the methoxy group can also enhance the compound's lipophilicity and affect its biological activity. Overall, 2,2-dideuterio-1-(4-methoxyphenyl)propan-1-one is of interest in various fields, including medicinal chemistry and isotope labeling studies, due to its structural features and isotopic composition.
Formula:C10H10D2O2
InChI:InChI=1/C10H12O2/c1-3-10(11)8-4-6-9(12-2)7-5-8/h4-7H,3H2,1-2H3/i3D2
SMILES:CC(C(=O)c1ccc(cc1)OC)([2H])[2H]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.