CAS 91889-40-6

Benzenemethanol, α-(ethyl-1,1-d2)-4-methoxy-

Description:

Benzenemethanol, α-(ethyl-1,1-d2)-4-methoxy- is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a methanol group and a methoxy group. The presence of the ethyl-1,1-d2 label indicates that the ethyl group is deuterated, meaning it contains deuterium, a stable isotope of hydrogen. This substitution can influence the compound's physical and chemical properties, such as its reactivity and isotopic labeling in studies. The methoxy group contributes to the compound's polarity and can affect its solubility in various solvents. The compound's structure suggests potential applications in organic synthesis, pharmaceuticals, or as a tracer in chemical research due to the deuterium labeling. Overall, the characteristics of this compound are defined by its functional groups, isotopic composition, and the presence of the aromatic benzene ring, which plays a crucial role in its chemical behavior and interactions.

Formula: C₁₀H₁₂D₂O₂

InChI: InChI=1S/C10H14O2/c1-3-10(11)8-4-6-9(12-2)7-5-8/h4-7,10-11H,3H2,1-2H3/i3D2

InChI key: InChIKey=RELLLNVFFUWXHI-SMZGMGDZSA-N

SMILES: C(C(C)([2H])[2H])(O)C1=CC=C(OC)C=C1

Synonyms:

• Benzenemethanol, α-(ethyl-1,1-d2)-4-methoxy-
• Benzenemethanol, α-(ethyl-1,1-d2)-4-methoxy-, (±)-
• 2,2-Dideuterio-1-(4-methoxyphenyl)propan-1-ol