CymitQuimica logo

CAS 91893-70-8

:

2-Amino-N,N-dimethylethanesulfonamide

Description:
2-Amino-N,N-dimethylethanesulfonamide, also known as a sulfonamide compound, is characterized by its sulfonamide functional group, which consists of a sulfonyl group (–SO2) attached to an amine. This compound features two methyl groups attached to the nitrogen atom, contributing to its dimethylamine structure. It is typically a white crystalline solid that is soluble in water due to the presence of the sulfonamide group, which enhances its polarity. The compound is known for its potential applications in pharmaceuticals, particularly as an antibacterial agent, owing to its structural similarity to other sulfonamides that inhibit bacterial growth. Additionally, it may exhibit properties such as low toxicity and moderate stability under standard conditions. Its molecular structure allows for various interactions, making it a subject of interest in medicinal chemistry and drug design. As with many sulfonamides, it may also participate in acid-base reactions due to the presence of the amino group, which can act as a weak base.
Formula:C4H12N2O2S
InChI:InChI=1S/C4H12N2O2S/c1-6(2)9(7,8)4-3-5/h3-5H2,1-2H3
InChI key:InChIKey=RTVWJWNJHGNHTD-UHFFFAOYSA-N
SMILES:S(CCN)(N(C)C)(=O)=O
Synonyms:
  • 2-(Dimethylsulfamoyl)ethylamine
  • 2-Amino-N,N-dimethylethane-1-sulfonamide
  • 2-Aminoethanesulfonic acid dimethylamide
  • ethanesulfonamide, 2-amino-N,N-dimethyl-
  • 2-Amino-N,N-dimethylethanesulfonamide
Found 3 products.