CAS 91896-57-0
:8-chloro-1-phenyl[1,2,4]triazolo[4,3-a]quinoxalin-4-amine
Description:
8-Chloro-1-phenyl[1,2,4]triazolo[4,3-a]quinoxalin-4-amine is a heterocyclic compound characterized by its complex structure, which includes a triazole and quinoxaline moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the chloro and phenyl groups can influence its reactivity and interaction with biological targets. It may also display specific pharmacological activities, which can be attributed to its unique structural features. The compound's molecular framework allows for potential applications in drug development, particularly in areas related to cancer research or as a scaffold for synthesizing other bioactive molecules. Additionally, its stability and reactivity can be influenced by the electronic effects of the substituents on the aromatic rings. Overall, 8-chloro-1-phenyl[1,2,4]triazolo[4,3-a]quinoxalin-4-amine represents a significant compound for further exploration in chemical and pharmaceutical research.
Formula:C15H10ClN5
InChI:InChI=1/C15H10ClN5/c16-10-6-7-11-12(8-10)21-14(9-4-2-1-3-5-9)19-20-15(21)13(17)18-11/h1-8H,(H2,17,18)
SMILES:c1ccc(cc1)c1nnc2c(N)nc3ccc(cc3n12)Cl
Synonyms:- [1,2,4]Triazolo[4,3-A]Quinoxalin-4-Amine, 8-Chloro-1-Phenyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
CP-66713
CAS:CP-66713 is a potentiator of adenosine receptors. It binds to the adenosine A1 receptor and blocks the presynaptic uptake of adenosine, thereby potentiating the effects of endogenous adenosine. CP-66713 has been shown to be effective in animal control experiments for depression, which may be due to its ability to increase levels of synaptic and hippocampal cAMP. CP-66713 also has anti-inflammatory properties, as it inhibits the release of polymorphonuclear leukocytes by inhibiting phosphodiesterase activity.Formula:C15H10ClN5Purity:Min. 95%Molecular weight:295.72 g/molCP 66713
CAS:CP-66713 is an adenosine A2 receptor antagonist.Formula:C15H10ClN5Color and Shape:SolidMolecular weight:295.73


