CAS 91896-58-1

[1,2,4]Triazolo[4,3-a]quinoxalin-4-amine, 8-chloro-1-phenyl-, methanesulfonate (1:1)

Description:

[1,2,4]Triazolo[4,3-a]quinoxalin-4-amine, 8-chloro-1-phenyl-, methanesulfonate (1:1) is a chemical compound characterized by its complex structure, which includes a triazole ring fused to a quinoxaline moiety. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, contributing to its potential biological activity. The presence of the methanesulfonate group suggests it may have solubility in polar solvents, enhancing its utility in various applications, including medicinal chemistry. The chloro and phenyl substituents can influence its reactivity and interaction with biological targets, potentially affecting its pharmacological properties. Compounds of this nature are often investigated for their roles in drug development, particularly in the context of targeting specific enzymes or receptors. Additionally, the compound's molecular structure may confer unique electronic properties, making it of interest in materials science and organic electronics. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.

Formula: C₁₅H₁₀ClN₅·CH₄O₃S

InChI: InChI=1S/C15H10ClN5.CH4O3S/c16-10-6-7-11-12(8-10)21-14(9-4-2-1-3-5-9)19-20-15(21)13(17)18-11;1-5(2,3)4/h1-8H,(H2,17,18);1H3,(H,2,3,4)

InChI key: InChIKey=YFLAFQXYLCULQP-UHFFFAOYSA-N

SMILES: NC=1C=2N(C=3C(N1)=CC=C(Cl)C3)C(=NN2)C4=CC=CC=C4.S(C)(=O)(=O)O

Synonyms:

• [1,2,4]Triazolo[4,3-a]quinoxalin-4-amine, 8-chloro-1-phenyl-, monomethanesulfonate
• [1,2,4]Triazolo[4,3-a]quinoxalin-4-amine, 8-chloro-1-phenyl-, methanesulfonate (1:1)

Cp-66713 mesylate

CAS: 91896-58-1

Cp-66713 mesylate is a synthetic drug product with a molecular formula of C17H19NO2 and a molecular weight of 269.34. It has the following CAS number: 91896-58-1. The purity of this compound is >99% (HPLC).

Formula: C₁₅H₁₀ClN₅

Purity: Min. 95%

Molecular weight: 295.72 g/mol

Ref: 3D-RDA89658