CymitQuimica logo

CAS 91898-93-0

:

Trisdichlorophtalimidotritylbromide

Description:
Trisdichlorophthalimidotritylbromide, with the CAS number 91898-93-0, is a chemical compound that belongs to the class of organic halides. It is characterized by the presence of multiple halogen atoms, specifically three chlorine atoms and one bromine atom, which contribute to its reactivity and potential applications in various chemical processes. The compound features a phthalimide structure, which is known for its stability and ability to participate in nucleophilic substitution reactions. Trisdichlorophthalimidotritylbromide is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to act as a reagent or intermediate. Its unique structure allows for selective reactivity, making it valuable in the formation of complex organic molecules. Safety considerations are important when handling this compound, as it may pose health risks due to its halogenated nature. Proper storage and handling protocols should be followed to mitigate any potential hazards associated with its use.
Formula:C43H18BrCl6N3O6
InChI:InChI=1/C43H18BrCl6N3O6/c44-43(19-1-7-22(8-2-19)51-37(54)25-13-31(45)32(46)14-26(25)38(51)55,20-3-9-23(10-4-20)52-39(56)27-15-33(47)34(48)16-28(27)40(52)57)21-5-11-24(12-6-21)53-41(58)29-17-35(49)36(50)18-30(29)42(53)59/h1-18H
SMILES:c1cc(ccc1C(c1ccc(cc1)N1C(=O)c2cc(c(cc2C1=O)Cl)Cl)(c1ccc(cc1)N1C(=O)c2cc(c(cc2C1=O)Cl)Cl)Br)N1C(=O)c2cc(c(cc2C1=O)Cl)Cl
Synonyms:
  • 4,4,4-Tris(4,5-dichlorophtalimido)trityl bromide [protecting
  • 2,2',2''-[(bromomethanetriyl)tribenzene-4,1-diyl]tris(5,6-dichloro-1H-isoindole-1,3(2H)-dione)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.