CAS 91900-33-3

2-chloro-N-[(1R)-1-(4-chlorophenyl)ethyl]acetamide

Description:

2-chloro-N-[(1R)-1-(4-chlorophenyl)ethyl]acetamide, with the CAS number 91900-33-3, is a chemical compound that belongs to the class of amides. It features a chloro substituent and an acetamide functional group, which contributes to its reactivity and potential biological activity. The presence of the 4-chlorophenyl group suggests that it may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. The compound's stereochemistry, indicated by the (1R) configuration, implies that it has a specific three-dimensional arrangement that can influence its pharmacological properties. Generally, compounds like this may be evaluated for their efficacy in various applications, including pharmaceuticals, due to their ability to interact with biological systems. Additionally, the presence of chlorine atoms can affect the compound's solubility, stability, and overall reactivity. As with many chemical substances, safety data and handling precautions are essential for laboratory work involving this compound.

Formula: C₁₀H₁₁Cl₂NO

InChI: InChI=1/C10H11Cl2NO/c1-7(13-10(14)6-11)8-2-4-9(12)5-3-8/h2-5,7H,6H2,1H3,(H,13,14)/t7-/m1/s1

SMILES: C[C@H](c1ccc(cc1)Cl)N=C(CCl)O

2-Chloro-N-[1-(4-chlorophenyl)ethyl]acetamide

CAS: 91900-33-3

Versatile small molecule scaffold

Formula: C₁₀H₁₁Cl₂NO

Purity: Min. 95%

Molecular weight: 232.1 g/mol

Ref: 3D-RDA90033