CAS 919016-97-0
:1-[3-(2-methoxyethoxy)phenyl]methanamine
Description:
1-[3-(2-methoxyethoxy)phenyl]methanamine, with the CAS number 919016-97-0, is an organic compound characterized by its amine functional group and a phenyl ring substituted with a methoxyethoxy group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The presence of the methoxyethoxy group enhances its lipophilicity, potentially affecting its biological activity and interaction with cellular membranes. The compound may be utilized in various applications, including medicinal chemistry, where it could serve as a scaffold for drug development or as a building block in organic synthesis. Its structural features suggest potential for interactions with biological targets, making it of interest in pharmacological research. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact would depend on further empirical studies.
Formula:C10H15NO2
InChI:InChI=1/C10H15NO2/c1-12-5-6-13-10-4-2-3-9(7-10)8-11/h2-4,7H,5-6,8,11H2,1H3
SMILES:COCCOc1cccc(c1)CN
Synonyms:- [3-(2-Methoxyethoxy)Phenyl]Methanamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
[3-(2-Methoxyethoxy)benzyl]amine
CAS:[3-(2-Methoxyethoxy)benzyl]amine is a high-quality chemical that can be used as an intermediate in the synthesis of complex compounds. It is also a useful scaffold for the synthesis of other chemicals, such as pharmaceuticals and pesticides. This compound also has many uses in research, such as being a versatile building block and reaction component.Formula:C10H15NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:181.23 g/mol1-[3-(2-methoxyethoxy)phenyl]methanamine
CAS:Formula:C10H15NO2Purity:95.0%Color and Shape:LiquidMolecular weight:181.235


