CAS 919016-99-2
:8-methoxy-3,4-dihydro-2H-1,5-benzodioxepine-7-carbaldehyde
Description:
8-Methoxy-3,4-dihydro-2H-1,5-benzodioxepine-7-carbaldehyde is a chemical compound characterized by its unique bicyclic structure, which includes a benzodioxepine core. This compound features a methoxy group (-OCH3) and an aldehyde functional group (-CHO), contributing to its reactivity and potential applications in organic synthesis. The presence of the methoxy group can influence the compound's solubility and polarity, while the aldehyde group is known for its reactivity in various chemical reactions, such as condensation and oxidation. The compound's structure suggests it may exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry. Additionally, its molecular configuration may allow for specific interactions with biological targets, which could be explored in drug development. Overall, 8-methoxy-3,4-dihydro-2H-1,5-benzodioxepine-7-carbaldehyde represents a fascinating subject for study due to its structural features and potential applications in various fields of chemistry and pharmacology.
Formula:C11H12O4
InChI:InChI=1/C11H12O4/c1-13-9-6-11-10(5-8(9)7-12)14-3-2-4-15-11/h5-7H,2-4H2,1H3
SMILES:COc1cc2c(cc1C=O)OCCCO2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.