CAS 91902-03-3

7-methyl-5-phenylpyrazolo[1,5-a]pyrimidin-2(1H)-one

Description:

7-Methyl-5-phenylpyrazolo[1,5-a]pyrimidin-2(1H)-one is a heterocyclic compound characterized by its unique pyrazolo-pyrimidine structure, which incorporates both pyrazole and pyrimidine rings. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry. Its molecular structure includes a methyl group at the 7-position and a phenyl group at the 5-position, contributing to its chemical reactivity and potential pharmacological properties. The presence of the carbonyl group at the 2-position enhances its ability to participate in various chemical reactions, such as nucleophilic attacks. Additionally, the compound may exhibit solubility in organic solvents, which is common for similar heterocyclic compounds. Its specific interactions with biological targets can lead to diverse therapeutic applications, including anti-inflammatory or anticancer activities. As with many heterocycles, the compound's stability, reactivity, and biological efficacy can be influenced by substituents and the overall electronic environment of the molecule.

Formula: C₁₃H₁₁N₃O

InChI: InChI=1/C13H11N3O/c1-9-7-11(10-5-3-2-4-6-10)14-12-8-13(17)15-16(9)12/h2-8H,1H3,(H,15,17)

SMILES: Cc1cc(c2ccccc2)nc2cc(nn12)O

Synonyms:

• 7-Methyl-5-Phenylpyrazolo[1,5-A]Pyrimidin-2-Ol

7-Methyl-5-phenylpyrazolo[1,5-a]pyrimidin-2-ol

CAS: 91902-03-3

Versatile small molecule scaffold

Formula: C₁₃H₁₁N₃O

Purity: Min. 95%

Molecular weight: 225.25 g/mol

Ref: 3D-RDA90203