CymitQuimica logo

CAS 91902-78-2

:

3-phenyl-2-(thiophen-2-yl)propanoic acid

Description:
3-Phenyl-2-(thiophen-2-yl)propanoic acid is an organic compound characterized by its unique structure, which includes a propanoic acid backbone substituted with a phenyl group and a thiophene ring. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and interactions. The presence of the carboxylic acid functional group (-COOH) imparts acidic characteristics, allowing it to participate in various chemical reactions, such as esterification and amidation. The aromatic rings enhance the compound's stability and may influence its solubility in organic solvents. Additionally, the thiophene moiety can contribute to electronic properties, making the compound of interest in materials science and organic synthesis. Its structural features may also suggest potential applications in pharmaceuticals or agrochemicals, where such compounds can exhibit biological activity. Overall, 3-phenyl-2-(thiophen-2-yl)propanoic acid represents a versatile chemical entity with diverse applications in research and industry.
Formula:C13H12O2S
InChI:InChI=1/C13H12O2S/c14-13(15)11(12-7-4-8-16-12)9-10-5-2-1-3-6-10/h1-8,11H,9H2,(H,14,15)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.