CymitQuimica logo

CAS 919026-20-3

:

2,6-dimethylmorpholine-4-sulfonyl chloride

Description:
2,6-Dimethylmorpholine-4-sulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group, which makes it a reactive agent in organic synthesis. It features a morpholine ring, which is a six-membered heterocyclic structure containing both nitrogen and oxygen atoms. The presence of two methyl groups at the 2 and 6 positions of the morpholine ring contributes to its steric properties and can influence its reactivity. This compound is typically used as a sulfonylating agent in the synthesis of various organic compounds, including pharmaceuticals and agrochemicals. It is known for its ability to introduce sulfonyl groups into target molecules, enhancing their biological activity or modifying their physical properties. As a sulfonyl chloride, it is also sensitive to moisture and should be handled with care, as it can react with water to produce hydrochloric acid and the corresponding sulfonic acid. Proper safety precautions, including the use of personal protective equipment, are essential when working with this compound due to its corrosive nature.
Formula:C6H12ClNO3S
InChI:InChI=1/C6H12ClNO3S/c1-5-3-8(12(7,9)10)4-6(2)11-5/h5-6H,3-4H2,1-2H3
SMILES:CC1CN(CC(C)O1)S(=O)(=O)Cl
Synonyms:
  • 4-Morpholinesulfonyl Chloride, 2,6-Dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.