CAS 91903-09-2

1-Methoxy-2-naphthaleneacetic acid

Description:

1-Methoxy-2-naphthaleneacetic acid, with the CAS number 91903-09-2, is an organic compound that belongs to the class of naphthalene derivatives. It features a naphthalene ring substituted with a methoxy group and an acetic acid moiety, which contributes to its unique chemical properties. This compound is typically characterized by its moderate solubility in organic solvents and limited solubility in water, reflecting its hydrophobic nature due to the naphthalene structure. It may exhibit biological activity, particularly in plant growth regulation, as it can mimic natural auxins, which are essential for plant development. The presence of the methoxy group can influence its reactivity and interaction with biological systems. Additionally, 1-Methoxy-2-naphthaleneacetic acid may undergo various chemical reactions, including esterification and oxidation, making it a versatile compound in synthetic organic chemistry. Its applications may extend to agricultural chemistry and research in plant physiology, although specific uses can vary based on ongoing studies and regulatory considerations.

Formula: C₁₃H₁₂O₃

InChI: InChI=1S/C13H12O3/c1-16-13-10(8-12(14)15)7-6-9-4-2-3-5-11(9)13/h2-7H,8H2,1H3,(H,14,15)

InChI key: InChIKey=NBZQLUCNDURPHV-UHFFFAOYSA-N

SMILES: O(C)C=1C2=C(C=CC1CC(O)=O)C=CC=C2

Synonyms:

• 2-(1-Methoxynaphthalen-2-yl)acetic acid
• 2-Naphthaleneacetic acid, 1-methoxy-
• 1-Methoxy-2-naphthaleneacetic acid