CymitQuimica logo

CAS 91903-26-3

:

5-[(benzylsulfanyl)methyl]furan-2-carboxylic acid

Description:
5-[(Benzylsulfanyl)methyl]furan-2-carboxylic acid is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of the benzylsulfanyl group indicates that it contains a sulfur atom bonded to a benzyl group, which can influence the compound's solubility and reactivity. The molecular structure suggests that it may exhibit both hydrophilic and hydrophobic characteristics, making it potentially useful in various chemical applications, including pharmaceuticals and agrochemicals. The compound's unique structure may also impart specific biological activities, although detailed studies would be necessary to elucidate its pharmacological properties. Additionally, the presence of the furan moiety may contribute to its stability and reactivity in organic synthesis. Overall, 5-[(benzylsulfanyl)methyl]furan-2-carboxylic acid is a compound of interest for further research in organic chemistry and medicinal applications.
Formula:C13H12O3S
InChI:InChI=1/C13H12O3S/c14-13(15)12-7-6-11(16-12)9-17-8-10-4-2-1-3-5-10/h1-7H,8-9H2,(H,14,15)
SMILES:c1ccc(cc1)CSCc1ccc(C(=O)O)o1
Synonyms:
  • 2-Furancarboxylic acid, 5-[[(phenylmethyl)thio]methyl]-
  • 5-[(Benzylsulfanyl)Methyl]-2-Furoic Acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.