CymitQuimica logo

CAS 91904-36-8

:

{2-[(4-methylpiperazin-1-yl)methyl]phenyl}methanol

Description:
{2-[(4-methylpiperazin-1-yl)methyl]phenyl}methanol, with the CAS number 91904-36-8, is an organic compound characterized by its complex structure that includes a phenyl ring, a methanol group, and a piperazine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which can influence its solubility and reactivity. It is likely to be a solid at room temperature, with potential applications in medicinal chemistry due to the presence of the piperazine ring, which is often found in pharmacologically active compounds. The methanol group can participate in hydrogen bonding, enhancing its interactions with biological targets. Additionally, the presence of the methyl group on the piperazine may affect its lipophilicity and overall biological activity. As with many organic compounds, its stability, reactivity, and potential uses would depend on the specific conditions under which it is handled and studied. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C13H20N2O
InChI:InChI=1/C13H20N2O/c1-14-6-8-15(9-7-14)10-12-4-2-3-5-13(12)11-16/h2-5,16H,6-11H2,1H3
SMILES:CN1CCN(CC1)Cc1ccccc1CO
Synonyms:
  • Benzenemethanol, 2-[(4-Methyl-1-Piperazinyl)Methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.