CAS 919077-81-9

N-cyclohexyl-1-(2,4-dichlorophenyl)-6-methyl-1,4-dihydroindeno[1,2-c]pyrazole-3-carboxamide

Description:

N-cyclohexyl-1-(2,4-dichlorophenyl)-6-methyl-1,4-dihydroindeno[1,2-c]pyrazole-3-carboxamide, with CAS number 919077-81-9, is a synthetic organic compound characterized by its complex structure, which includes a pyrazole ring fused to an indeno framework. This compound features a cyclohexyl group and a dichlorophenyl substituent, contributing to its potential biological activity. Typically, such compounds are investigated for their pharmacological properties, including anti-inflammatory or analgesic effects, due to the presence of the carboxamide functional group, which can enhance solubility and bioavailability. The presence of halogen atoms, like chlorine, often influences the compound's reactivity and interaction with biological targets. In terms of physical properties, while specific values such as melting point or solubility are not provided, compounds of this nature are generally expected to exhibit moderate to high lipophilicity, which can affect their distribution in biological systems. Overall, this compound represents a class of molecules that may have significant implications in medicinal chemistry and drug development.

Formula: C₂₄H₂₃Cl₂N₃O

InChI: InChI=1/C24H23Cl2N3O/c1-14-7-9-18-15(11-14)12-19-22(24(30)27-17-5-3-2-4-6-17)28-29(23(18)19)21-10-8-16(25)13-20(21)26/h7-11,13,17H,2-6,12H2,1H3,(H,27,30)

SMILES: Cc1ccc2c(c1)Cc1c(C(=NC3CCCCC3)O)nn(c3ccc(cc3Cl)Cl)c21

GP 2A

Controlled Product

CAS: 919077-81-9

Formula: C₂₄H₂₃Cl₂N₃O

Color and Shape: Neat

Molecular weight: 440.365

Ref: TR-G932015

CB2 receptor agonist 3

CAS: 919077-81-9

GP 2A is a selective agonist of CB2 receptor.

Formula: C₂₄H₂₃Cl₂N₃O

Color and Shape: Solid

Molecular weight: 440.36

Ref: TM-T24097