CymitQuimica logo

CAS 91908-88-2

:

1-[(3,4-dimethoxyphenyl)sulfonyl]piperazine

Description:
1-[(3,4-Dimethoxyphenyl)sulfonyl]piperazine is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. The compound features a sulfonyl group attached to a phenyl ring that is further substituted with two methoxy groups at the 3 and 4 positions. This structural arrangement contributes to its potential biological activity and solubility properties. The presence of the sulfonyl moiety often enhances the compound's reactivity and can influence its interaction with biological targets. Additionally, the methoxy groups can affect the compound's lipophilicity and overall pharmacokinetic profile. As a result, 1-[(3,4-dimethoxyphenyl)sulfonyl]piperazine may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its CAS number, 91908-88-2, allows for easy identification and reference in chemical databases and literature.
Formula:C12H18N2O4S
InChI:InChI=1/C12H18N2O4S/c1-17-11-4-3-10(9-12(11)18-2)19(15,16)14-7-5-13-6-8-14/h3-4,9,13H,5-8H2,1-2H3
SMILES:COc1ccc(cc1OC)S(=O)(=O)N1CCNCC1
Synonyms:
  • Piperazine, 1-[(3,4-Dimethoxyphenyl)Sulfonyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.