CAS 919085-47-5

2-Chloro-4-(3-nitrophenyl)-1,3,5-triazine

Description:

2-Chloro-4-(3-nitrophenyl)-1,3,5-triazine is a heterocyclic organic compound characterized by its triazine ring structure, which consists of three nitrogen atoms and three carbon atoms. This compound features a chlorine substituent at the 2-position and a nitrophenyl group at the 4-position, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the nitro group enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. This compound is of interest in fields such as agrochemicals and pharmaceuticals, where it may serve as an intermediate in the synthesis of more complex molecules. Additionally, its chlorinated structure may impart specific biological activities, making it relevant for research in medicinal chemistry. Safety data should be consulted, as compounds with halogen and nitro groups can pose environmental and health risks.

Formula: C₉H₅ClN₄O₂

InChI: InChI=1S/C9H5ClN4O2/c10-9-12-5-11-8(13-9)6-2-1-3-7(4-6)14(15)16/h1-5H

InChI key: InChIKey=XKTNKDXCEGXHEA-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C=C(C=CC1)C=2N=C(Cl)N=CN2

Synonyms:

• 2-Chloro-4-(3-nitrophenyl)-1,3,5-triazine
• 1,3,5-Triazine, 2-chloro-4-(3-nitrophenyl)-

2-Chloro-4-(3-nitrophenyl)-1,3,5-triazine

CAS: 919085-47-5

2-Chloro-4-(3-nitrophenyl)-1,3,5-triazine

Purity: 95%

Molecular weight: 236.61g/mol

Ref: 54-OR300585

2-Chloro-4-(3-nitro-phenyl)-[1,3,5]-triazine

CAS: 919085-47-5

Formula: C₉H₅ClN₄O₂

Purity: 95.0%

Molecular weight: 236.62

Ref: 10-F047514