CAS 919098-94-5
:3-aminotetrahydrofuran-3-carboxylic acid hydrochloride
Description:
3-Aminotetrahydrofuran-3-carboxylic acid hydrochloride is a chemical compound characterized by its unique structure, which includes a tetrahydrofuran ring with an amino group and a carboxylic acid functional group. This compound is typically a white to off-white crystalline solid, soluble in water and polar organic solvents due to the presence of the carboxylic acid and amino groups, which can engage in hydrogen bonding. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, enhancing its stability and solubility. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs or as a building block in organic synthesis. Its properties, such as melting point, pH, and reactivity, can vary based on the specific conditions and purity of the sample. As with many amino acids and their derivatives, it may participate in various chemical reactions, including peptide bond formation, making it relevant in biochemistry and medicinal chemistry.
Formula:C5H10ClNO3
InChI:InChI=1/C5H9NO3.ClH/c6-5(4(7)8)1-2-9-3-5;/h1-3,6H2,(H,7,8);1H
Synonyms:- 3-aminotetrahydrofuran-3-carboxylic acid hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Aminotetrahydrofuran-3-carboxylic acid hydrochloride
CAS:Formula:C5H10ClNO3Molecular weight:167.5908
