
CAS 919116-51-1
:(4-Amino-2-chlorophenyl)(4-methyl-1-piperazinyl)methanone
Description:
(4-Amino-2-chlorophenyl)(4-methyl-1-piperazinyl)methanone, identified by its CAS number 919116-51-1, is a chemical compound characterized by its complex structure that includes an amino group, a chlorophenyl moiety, and a piperazine ring. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the amino group suggests it may engage in hydrogen bonding, enhancing its solubility in polar solvents. The chlorophenyl group can influence the compound's electronic properties and reactivity, while the piperazine ring is known for its role in pharmacological activity, often contributing to the compound's interaction with biological targets. Overall, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could facilitate interactions with various biological pathways. However, specific applications and biological activities would require further investigation through empirical studies.
Formula:C12H16ClN3O
InChI:InChI=1S/C12H16ClN3O/c1-15-4-6-16(7-5-15)12(17)10-3-2-9(14)8-11(10)13/h2-3,8H,4-7,14H2,1H3
InChI key:InChIKey=VGKLZDHLZKPMNI-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(Cl)C=C(N)C=C1)N2CCN(C)CC2
Synonyms:- 3-Chloro-4-[(4-methyl-1-piperazinyl)carbonyl]aniline
- 3-Chloro-4-(4-methylpiperazine-1-carbonyl)aniline
- (4-Amino-2-chlorophenyl)(4-methylpiperazin-1-yl)methanone
- Methanone, (4-amino-2-chlorophenyl)(4-methyl-1-piperazinyl)-
- (4-Amino-2-chlorophenyl)(4-methyl-1-piperazinyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.