CymitQuimica logo

CAS 919119-61-2

:

5-Methoxy-2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole

Description:
5-Methoxy-2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole is a chemical compound characterized by its complex structure, which includes an indole core substituted with a methoxy group and a dioxaborolane moiety. The presence of the methoxy group enhances its solubility and may influence its reactivity and biological activity. The dioxaborolane group is notable for its role in organoboron chemistry, often utilized in cross-coupling reactions and as a boron source in various synthetic applications. This compound may exhibit unique properties such as fluorescence or specific interactions with biological targets, making it of interest in medicinal chemistry and materials science. Its molecular structure suggests potential applications in drug development or as a building block in organic synthesis. As with many organoboron compounds, careful handling and storage are recommended due to their sensitivity to moisture and air, which can affect their stability and reactivity.
Formula:C16H22BNO3
InChI:InChI=1S/C16H22BNO3/c1-10-7-11-8-12(19-6)9-13(14(11)18-10)17-20-15(2,3)16(4,5)21-17/h7-9,18H,1-6H3
InChI key:InChIKey=AAUQGODVSUVOLU-UHFFFAOYSA-N
SMILES:O(C)C1=CC(=C2C(=C1)C=C(C)N2)B3OC(C)(C)C(C)(C)O3
Synonyms:
  • 5-Methoxy-2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole
  • 1H-Indole, 5-methoxy-2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.