
CAS 919119-71-4
:2-Phenyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole
Description:
2-Phenyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole is a chemical compound characterized by its complex structure, which includes an indole core substituted with a phenyl group and a boron-containing dioxaborolane moiety. This compound typically exhibits properties associated with both indole derivatives and boron compounds, such as potential applications in organic synthesis and materials science. The presence of the dioxaborolane group suggests reactivity in cross-coupling reactions, making it valuable in the development of pharmaceuticals and agrochemicals. Additionally, the tetramethyl substitution enhances its stability and solubility in organic solvents. The compound may also display interesting photophysical properties, which can be exploited in optoelectronic applications. Overall, 2-Phenyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole represents a versatile building block in synthetic organic chemistry, with potential implications in various fields, including medicinal chemistry and materials science.
Formula:C20H22BNO2
InChI:InChI=1S/C20H22BNO2/c1-19(2)20(3,4)24-21(23-19)16-12-8-11-15-13-17(22-18(15)16)14-9-6-5-7-10-14/h5-13,22H,1-4H3
InChI key:InChIKey=DXVZBMDOCREPDQ-UHFFFAOYSA-N
SMILES:CC1(C)OB(C2=C3C(C=C(N3)C4=CC=CC=C4)=CC=C2)OC1(C)C
Synonyms:- 2-Phenyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole
- 1H-Indole, 2-phenyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Phenyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole
CAS:Formula:C20H22BNO2Molecular weight:319.2052
