CymitQuimica logo

CAS 91912-54-8

:

1-Iodo-4-(methoxymethyl)benzene

Description:
1-Iodo-4-(methoxymethyl)benzene, with the CAS number 91912-54-8, is an organic compound characterized by the presence of an iodine atom and a methoxymethyl group attached to a benzene ring. This compound features a benzene core, which is a stable aromatic structure, providing it with unique chemical properties such as increased stability and reactivity in electrophilic substitution reactions. The iodine substituent enhances the compound's reactivity, making it a useful intermediate in organic synthesis, particularly in the formation of carbon-carbon bonds. The methoxymethyl group contributes to the compound's solubility in organic solvents and can participate in various chemical reactions, including nucleophilic substitutions. Additionally, the presence of both iodine and the methoxymethyl group can influence the compound's physical properties, such as boiling and melting points, as well as its reactivity profile. Overall, 1-Iodo-4-(methoxymethyl)benzene serves as a valuable building block in the synthesis of more complex organic molecules in medicinal chemistry and materials science.
Formula:C8H9IO
InChI:InChI=1S/C8H9IO/c1-10-6-7-2-4-8(9)5-3-7/h2-5H,6H2,1H3
InChI key:InChIKey=DCQYAEJVEBYSTJ-UHFFFAOYSA-N
SMILES:C(OC)C1=CC=C(I)C=C1
Synonyms:
  • Ether, p-iodobenzyl methyl
  • 4-(Methoxymethyl)iodobenzene
  • 1-Iodo-4-(methoxymethyl)benzene
  • Benzene, 1-iodo-4-(methoxymethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.