
CAS 91914-05-5
:2-Pyridinol, 4-methyl-
Description:
2-Pyridinol, 4-methyl- is an organic compound characterized by a pyridine ring with a hydroxyl group (-OH) and a methyl group (-CH3) attached to the second and fourth positions, respectively. This compound is a derivative of pyridine, which is a six-membered aromatic ring containing one nitrogen atom. The presence of the hydroxyl group imparts some polar characteristics, making it soluble in water to a certain extent, while the methyl group contributes to its hydrophobic properties. 2-Pyridinol, 4-methyl- is often used in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals and agrochemicals. Its chemical behavior is influenced by the functional groups present, allowing it to participate in hydrogen bonding and other interactions. Additionally, this compound may exhibit biological activity, although specific applications and effects would depend on further research and context. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C6H7NO
InChI:InChI=1S/C6H7NO/c1-5-2-3-7-6(8)4-5/h2-4H,1H3,(H,7,8)
InChI key:InChIKey=YBDRFJXGJQULGH-UHFFFAOYSA-N
SMILES:CC=1C=C(O)N=CC1
Synonyms:- 2-Pyridinol, 4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.