CAS 91917-64-5

2,7b-Diazabenzo[f]cycloprop[cd]indene-4,7-dione, 3-[[(aminocarbonyl)oxy]methyl]-1,2,2a,3,7c,7d-hexahydro-2a,5-dimethoxy-6-methyl-, (2aR,3S,7cS,7dS)-

Description:

2,7b-Diazabenzo[f]cycloprop[cd]indene-4,7-dione, with the CAS number 91917-64-5, is a complex organic compound characterized by its unique bicyclic structure that incorporates both nitrogen and carbon atoms. This substance features a diazabenzocyclopropane framework, which contributes to its potential biological activity. The presence of functional groups such as methoxy and aminocarbonyl indicates that it may exhibit various chemical reactivities, including hydrogen bonding and nucleophilic interactions. Its stereochemistry, denoted by the specific configuration at multiple chiral centers, suggests that it may have distinct isomeric forms, which can influence its pharmacological properties. The compound is likely to be soluble in organic solvents, and its stability may be affected by environmental conditions such as pH and temperature. Given its structural complexity, it may be of interest in medicinal chemistry, particularly in the development of novel therapeutic agents. However, detailed studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₆H₁₉N₃O₆

InChI: InChI=1S/C16H19N3O6/c1-6-11(20)10-9(12(21)13(6)23-2)7(5-25-15(17)22)16(24-3)14-8(4-18-16)19(10)14/h7-8,14,18H,4-5H2,1-3H3,(H2,17,22)/t7-,8+,14+,16-,19?/m1/s1

InChI key: InChIKey=YKXDGMVCESRRDO-VFWICMBZSA-N

SMILES: O(C)[C@]12[C@]3(N([C@]3(CN1)[H])C4=C([C@H]2COC(N)=O)C(=O)C(OC)=C(C)C4=O)[H]

Synonyms:

• 2,7b-Diazabenzo[f]cycloprop[cd]indene-4,7-dione, 3-[[(aminocarbonyl)oxy]methyl]-1,2,2a,3,7c,7d-hexahydro-2a,5-dimethoxy-6-methyl-, [2aR-(2aα,3α,7cα,7dα)]-
• AX 2 (neoplasm inhibitor)
• AX 2
• Isomitomycin A
• 2,7b-Diazabenzo[f]cycloprop[cd]indene-4,7-dione, 3-[[(aminocarbonyl)oxy]methyl]-1,2,2a,3,7c,7d-hexahydro-2a,5-dimethoxy-6-methyl-, (2aR,3S,7cS,7dS)-

Isomitomycin A

CAS: 91917-64-5

Isomitomycin A is a naturally occurring microbial metabolite, which is isolated from certain strains of actinomycetes. It exhibits a unique mode of action by interfering with viral replication processes, effectively inhibiting the proliferation of various viral pathogens. The alkaloidal structure of Isomitomycin A allows it to integrate into nucleic acid processing pathways, eventually disrupting the function and synthesis of viral genomes.

Formula: C₁₆H₁₉N₃O₆

Purity: Min. 95%

Molecular weight: 349.34 g/mol

Ref: 3D-AI44466

Isoomitomycin A

CAS: 91917-64-5

Formula: C₁₆H₁₉N₃O₆

Molecular weight: 349.3

Ref: ST-EA-CP-M86009