CAS 91925-76-7

4-[2-(3-hydroxy-5-methoxyphenyl)ethyl]-2-(3-methylbut-2-en-1-yl)phenol

Description:

The chemical substance known as 4-[2-(3-hydroxy-5-methoxyphenyl)ethyl]-2-(3-methylbut-2-en-1-yl)phenol, with the CAS number 91925-76-7, is a phenolic compound characterized by its complex structure, which includes multiple aromatic rings and functional groups. This compound features a hydroxyl group and a methoxy group, contributing to its potential biological activity and solubility properties. The presence of the 3-methylbut-2-en-1-yl group suggests that it may exhibit unique reactivity and interactions due to the presence of a double bond. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, or as antioxidants due to their ability to donate hydrogen atoms. The molecular structure indicates that it may possess both lipophilic and hydrophilic characteristics, influencing its behavior in biological systems. Overall, this compound's specific properties, including its melting point, boiling point, and solubility, would need to be determined through experimental methods for precise applications and safety assessments.

Formula: C₂₀H₂₄O₃

InChI: InChI=1/C20H24O3/c1-14(2)4-8-17-10-15(7-9-20(17)22)5-6-16-11-18(21)13-19(12-16)23-3/h4,7,9-13,21-22H,5-6,8H2,1-3H3

SMILES: CC(=CCc1cc(CCc2cc(cc(c2)OC)O)ccc1O)C

Synonyms:

• 4-(2-(3-Hydroxy-5-methoxyphenyl)ethyl)-2-(3-methyl-2-butenyl)phenol
• Phenol, 4-(2-(3-hydroxy-5-methoxyphenyl)ethyl)-2-(3-methyl-2-butenyl)-

Cannabistilbene I

CAS: 91925-76-7

Cannabistilbene I is a naturally occurring compound that acts as a cannabinoid derivative, which is sourced from cannabis plants. It is characterized by its stilbene structure that binds to cannabinoid receptors in the body. This binding potentially modulates the endocannabinoid system, influencing various physiological responses.

Formula: C₂₀H₂₄O₃

Purity: Min. 95%

Molecular weight: 312.4 g/mol

Ref: 3D-RDA92576