CAS 919278-51-6

4-Chloro-5-methyl-5H-pyrrolo[3,2-d]pyrimidine-6-carbonitrile

Description:

4-Chloro-5-methyl-5H-pyrrolo[3,2-d]pyrimidine-6-carbonitrile is a heterocyclic organic compound characterized by its complex bicyclic structure, which incorporates both pyrrole and pyrimidine rings. This compound features a chloro substituent at the 4-position and a methyl group at the 5-position of the pyrrole ring, along with a carbonitrile functional group at the 6-position of the pyrimidine ring. The presence of these functional groups contributes to its potential reactivity and biological activity. Typically, compounds of this nature are of interest in medicinal chemistry due to their potential as pharmaceutical agents, particularly in targeting specific biological pathways. The molecular structure suggests that it may exhibit properties such as lipophilicity and the ability to form hydrogen bonds, which can influence its solubility and interaction with biological targets. Additionally, the compound's CAS number, 919278-51-6, serves as a unique identifier for regulatory and research purposes, facilitating its study and application in various scientific fields.

Formula: C₈H₅ClN₄

InChI: InChI=1S/C8H5ClN4/c1-13-5(3-10)2-6-7(13)8(9)12-4-11-6/h2,4H,1H3

InChI key: InChIKey=BROGSIDGMQGUOF-UHFFFAOYSA-N

SMILES: CN1C=2C(C=C1C#N)=NC=NC2Cl

Synonyms:

• 5H-Pyrrolo[3,2-d]pyrimidine-6-carbonitrile, 4-chloro-5-methyl-
• 4-Chloro-5-methyl-5H-pyrrolo[3,2-d]pyrimidine-6-carbonitrile