CymitQuimica logo

CAS 919301-53-4

:

Pyrimidine, 4-(4-chlorophenyl)-2,6-diphenyl-

Description:
Pyrimidine, 4-(4-chlorophenyl)-2,6-diphenyl- is a heterocyclic organic compound characterized by a pyrimidine ring substituted with two phenyl groups and a para-chlorophenyl group. The presence of the pyrimidine ring, which consists of a six-membered ring containing two nitrogen atoms at positions 1 and 3, imparts unique chemical properties, including potential basicity and reactivity in nucleophilic substitution reactions. The chlorophenyl substituent enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The diphenyl groups contribute to the compound's overall stability and can affect its electronic properties. This compound may exhibit various physical properties such as solubility in organic solvents and specific melting or boiling points, which are influenced by its molecular structure. Additionally, due to its structural features, it may interact with biological targets, making it a candidate for further research in pharmacology or material science. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogen substituents.
Formula:C22H15ClN2
InChI:InChI=1S/C22H15ClN2/c23-19-13-11-17(12-14-19)21-15-20(16-7-3-1-4-8-16)24-22(25-21)18-9-5-2-6-10-18/h1-15H
InChI key:AJSOWJLBAVMDJX-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C2=CC(=NC(=N2)C3=CC=CC=C3)C4=CC=C(C=C4)Cl
Found 4 products.