CymitQuimica logo

CAS 91933-54-9

:

2-[(5-methylisoxazol-3-yl)amino]-2-oxo-acetic acid

Description:
2-[(5-methylisoxazol-3-yl)amino]-2-oxo-acetic acid, with the CAS number 91933-54-9, is a chemical compound characterized by its unique structure that includes an isoxazole ring and an amino acid moiety. This compound features a 5-methylisoxazole group, which contributes to its biological activity and potential pharmacological properties. The presence of the amino and keto functional groups suggests that it may participate in various chemical reactions, including those typical of amino acids and carboxylic acids. Its molecular structure indicates it may exhibit polar characteristics, influencing its solubility in water and organic solvents. Additionally, the compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential interactions with biological targets. Understanding its stability, reactivity, and interaction with other molecules is crucial for exploring its applications in research and industry. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.
Formula:C6H6N2O4
InChI:InChI=1/C6H6N2O4/c1-3-2-4(8-12-3)7-5(9)6(10)11/h2H,1H3,(H,10,11)(H,7,8,9)
SMILES:Cc1cc(=NC(=O)C(=O)O)[nH]o1
Synonyms:
  • [(5-Methyl-1,2-Oxazol-3-Yl)Amino](Oxo)Acetic Acid
  • Acetic Acid, 2-[(5-Methyl-3-Isoxazolyl)Amino]-2-Oxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.