CymitQuimica logo

CAS 919347-14-1

:

N-(2-Methoxyethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinemethanamine

Description:
N-(2-Methoxyethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinemethanamine, with CAS number 919347-14-1, is a chemical compound that features a pyridine ring substituted with an amine group and a boron-containing moiety. This compound is characterized by its unique structure, which includes a methoxyethyl group that enhances its solubility in organic solvents and potentially influences its biological activity. The presence of the dioxaborolane group suggests that it may participate in boron chemistry, which is often utilized in organic synthesis and medicinal chemistry for its ability to form stable complexes. The compound's molecular structure indicates potential applications in drug development, particularly in targeting specific biological pathways. Additionally, its properties may include moderate to high polarity due to the methoxy group, which can affect its interaction with biological systems. Overall, this compound exemplifies the intersection of organic chemistry and pharmacology, highlighting the importance of boron-containing compounds in modern chemical research.
Formula:C15H25BN2O3
InChI:InChI=1S/C15H25BN2O3/c1-14(2)15(3,4)21-16(20-14)13-8-12(10-18-11-13)9-17-6-7-19-5/h8,10-11,17H,6-7,9H2,1-5H3
InChI key:InChIKey=OOBAZHVMVJNQKD-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C(CNCCOC)C=NC2
Synonyms:
  • N-(2-Methoxyethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinemethanamine
  • 3-Pyridinemethanamine, N-(2-methoxyethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.