CAS 919347-18-5
:N,N-Dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinemethanamine
Description:
N,N-Dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinemethanamine is a chemical compound characterized by its unique structure, which includes a pyridine ring and a boron-containing moiety. The presence of the dimethylamino group enhances its basicity and solubility in polar solvents, making it potentially useful in various chemical applications, including organic synthesis and medicinal chemistry. The dioxaborolane group contributes to its reactivity, particularly in reactions involving boron chemistry, such as cross-coupling reactions. This compound may exhibit specific biological activities due to the pyridine ring, which is often associated with pharmacological properties. Its stability and reactivity can be influenced by the steric hindrance provided by the tetramethyl groups, which may affect its interactions with other molecules. Overall, this compound represents a versatile structure with potential applications in both synthetic and medicinal chemistry, although detailed studies would be necessary to fully elucidate its properties and reactivity.
Formula:C14H23BN2O2
InChI:InChI=1S/C14H23BN2O2/c1-13(2)14(3,4)19-15(18-13)12-7-11(8-16-9-12)10-17(5)6/h7-9H,10H2,1-6H3
InChI key:InChIKey=VPGWNGOZKQDBEB-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C(CN(C)C)C=NC2
Synonyms:- 3-Pyridinemethanamine, N,N-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- dimethyl[[5-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)pyridin-3-yl]methyl]amine
- N,N-Dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinemethanamine
- N,N-diMethyl-1-(5-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-yl)MethanaMine
- Dimethyl-[5-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-pyridin-3-ylmethyl]-amine
- 125868
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N,N-Dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinemethanamine
CAS:Formula:C14H23BN2O2Molecular weight:262.1556
