CAS 919347-21-0
:N-(2,2-Dimethylpropyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinemethanamine
Description:
N-(2,2-Dimethylpropyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinemethanamine is a chemical compound characterized by its complex structure, which includes a pyridine ring and a boron-containing moiety. The presence of the dioxaborolane group suggests potential applications in organic synthesis and medicinal chemistry, particularly in the development of boron-containing pharmaceuticals. The compound features a branched alkyl chain (2,2-dimethylpropyl), which may influence its solubility and lipophilicity, affecting its biological activity and pharmacokinetics. The pyridine ring contributes to the compound's basicity and potential interactions with biological targets. Additionally, the presence of multiple methyl groups in the dioxaborolane enhances steric hindrance, which can impact reactivity and stability. Overall, this compound's unique structural features may provide valuable insights into its reactivity, potential applications in drug design, and interactions within biological systems. Further studies would be necessary to elucidate its specific properties and potential uses in various fields.
Formula:C17H29BN2O2
InChI:InChI=1S/C17H29BN2O2/c1-15(2,3)12-20-10-13-8-14(11-19-9-13)18-21-16(4,5)17(6,7)22-18/h8-9,11,20H,10,12H2,1-7H3
InChI key:InChIKey=FFRFPAHWKBEDOC-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C(CNCC(C)(C)C)C=NC2
Synonyms:- 2,2-Dimethyl-N-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-yl]methyl]propan-1-amine
- 3-Pyridinemethanamine, N-(2,2-dimethylpropyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- N-(2,2-Dimethylpropyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,2-Dimethyl-N-((5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-yl)methyl)propan-1-amine
CAS:Formula:C17H29BN2O2Molecular weight:304.2354
