CymitQuimica logo

CAS 919347-59-4

:

5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-N-(2,2,2-trifluoroethyl)-3-pyridinemethanamine

Description:
The chemical substance known as "5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-N-(2,2,2-trifluoroethyl)-3-pyridinemethanamine" with CAS number 919347-59-4 is a complex organic compound featuring a pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound is characterized by the presence of a boron-containing moiety, specifically a dioxaborolane, which contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The trifluoroethyl group enhances its lipophilicity and may influence its biological activity. The presence of the amine functional group suggests potential for hydrogen bonding and interactions with biological targets. Overall, this compound may exhibit unique properties due to its structural features, making it of interest in various fields, including pharmaceuticals and materials science. Its specific characteristics, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other functional groups in the molecular structure.
Formula:C14H20BF3N2O2
InChI:InChI=1S/C14H20BF3N2O2/c1-12(2)13(3,4)22-15(21-12)11-5-10(6-19-8-11)7-20-9-14(16,17)18/h5-6,8,20H,7,9H2,1-4H3
InChI key:InChIKey=HBHDWFVCAGTJQN-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C(CNCC(F)(F)F)C=NC2
Synonyms:
  • 3-Pyridinemethanamine, 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-(2,2,2-trifluoroethyl)-
  • 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-N-(2,2,2-trifluoroethyl)-3-pyridinemethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.