CymitQuimica logo

CAS 919347-92-5

:

1-(3,5-dimethyl-1H-pyrazol-4-yl)-N-methyl-methanamine

Description:
1-(3,5-dimethyl-1H-pyrazol-4-yl)-N-methyl-methanamine, with the CAS number 919347-92-5, is a chemical compound characterized by its unique structure that includes a pyrazole ring and a methylated amine group. This compound typically exhibits properties associated with both heterocyclic and amine functionalities, which may influence its solubility, reactivity, and potential biological activity. The presence of the dimethyl groups on the pyrazole ring can enhance lipophilicity, potentially affecting its interaction with biological membranes. As a pyrazole derivative, it may exhibit various pharmacological activities, making it of interest in medicinal chemistry. The compound's molecular structure suggests it could participate in hydrogen bonding and other intermolecular interactions, which are crucial for its behavior in different environments. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including spectroscopic methods for confirmation of its structure. Overall, this compound represents a class of organic molecules that may have applications in pharmaceuticals or agrochemicals, depending on its specific properties and activities.
Formula:C7H13N3
InChI:InChI=1/C7H13N3/c1-5-7(4-8-3)6(2)10-9-5/h8H,4H2,1-3H3,(H,9,10)
SMILES:Cc1c(CNC)c(C)n[nH]1
Synonyms:
  • 1-(3,5-Dimethyl-1H-pyrazol-4-yl)-N-methylmethanamin
  • 1-(3,5-dimethyl-1H-pyrazol-4-yl)-N-methylmethanamine
  • 1H-pyrazole-4-methanamine, N,3,5-trimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.