CAS 91935-84-1

3,3,4,4,4-pentafluoro-2-hydroxy-2-(p-tolyl)butanoic acid

Description:

3,3,4,4,4-pentafluoro-2-hydroxy-2-(p-tolyl)butanoic acid is a fluorinated organic compound characterized by its unique structure, which includes multiple fluorine atoms and a hydroxyl group attached to a butanoic acid backbone. The presence of five fluorine atoms contributes to its high lipophilicity and potential applications in various fields, including pharmaceuticals and agrochemicals. The p-tolyl group, derived from toluene, enhances the compound's hydrophobic properties, making it useful in formulations where solubility in organic solvents is desired. This compound is likely to exhibit strong acidity due to the carboxylic acid functional group, which can participate in hydrogen bonding and influence its reactivity. Additionally, the fluorinated nature of the compound may impart unique physical properties, such as increased thermal stability and resistance to degradation. Overall, 3,3,4,4,4-pentafluoro-2-hydroxy-2-(p-tolyl)butanoic acid is a complex molecule with significant potential in specialized applications due to its distinctive chemical characteristics.

Formula: C₁₁H₉F₅O₃

InChI: InChI=1/C11H9F5O3/c1-6-2-4-7(5-3-6)9(19,8(17)18)10(12,13)11(14,15)16/h2-5,19H,1H3,(H,17,18)

SMILES: Cc1ccc(cc1)C(C(=O)O)(C(C(F)(F)F)(F)F)O