CymitQuimica logo

CAS 919355-29-6

:

1,1-bis(dimethoxyphosphoryl)-2-(3-pyridyl)ethanol

Description:
1,1-bis(dimethoxyphosphoryl)-2-(3-pyridyl)ethanol is a chemical compound characterized by its unique structure, which includes a pyridine ring and two dimethoxyphosphoryl groups attached to a central ethanol backbone. This compound is typically classified as a phosphonate, which suggests it may exhibit properties associated with organophosphorus chemistry. The presence of the pyridine moiety indicates potential biological activity, as pyridine derivatives are often found in pharmaceuticals and agrochemicals. The dimethoxyphosphoryl groups contribute to the compound's reactivity and may enhance its solubility in organic solvents. Additionally, the compound may exhibit polar characteristics due to the hydroxyl group and the phosphonate functionalities, influencing its interactions in various chemical environments. Its specific applications and behavior would depend on further studies, including its reactivity, stability, and potential uses in medicinal chemistry or as a biochemical tool. As with many organophosphorus compounds, safety and handling precautions are essential due to potential toxicity.
Formula:C11H19NO7P2
InChI:InChI=1/C11H19NO7P2/c1-16-20(14,17-2)11(13,21(15,18-3)19-4)8-10-6-5-7-12-9-10/h5-7,9,13H,8H2,1-4H3
SMILES:COP(=O)(C(Cc1cccnc1)(O)P(=O)(OC)OC)OC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Tetramethyl Risedronate

    Controlled Product
    CAS:
    Formula:C11H19NO7P2
    Color and Shape:Neat
    Molecular weight:339.22

    Ref: TR-T305300

    100mg
    3,428.00€