CAS 919360-50-2

1,1-Dimethylethyl 4-(3-hydroxybutyl)-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 4-(3-hydroxybutyl)-1-piperidinecarboxylate, identified by its CAS number 919360-50-2, is a chemical compound that features a piperidine ring, which is a six-membered nitrogen-containing heterocycle. This compound is characterized by the presence of a tert-butyl group (1,1-dimethylethyl) and a hydroxybutyl substituent, which contribute to its structural complexity and potential biological activity. The ester functional group in the carboxylate portion suggests that it may exhibit properties typical of esters, such as volatility and reactivity with nucleophiles. The hydroxy group can impart hydrophilicity, influencing solubility in polar solvents. This compound may be of interest in medicinal chemistry due to its structural features, which could be relevant for interactions with biological targets. However, specific information regarding its physical properties, reactivity, and applications would require further investigation through experimental data or literature. Overall, the unique combination of functional groups in this compound suggests potential utility in various chemical and pharmaceutical applications.

Formula: C₁₄H₂₇NO₃

InChI: InChI=1S/C14H27NO3/c1-11(16)5-6-12-7-9-15(10-8-12)13(17)18-14(2,3)4/h11-12,16H,5-10H2,1-4H3

InChI key: InChIKey=IXFWHVOBGBHGER-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CCC(CCC(C)O)CC1

Synonyms:

• 1-Piperidinecarboxylic acid, 4-(3-hydroxybutyl)-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 4-(3-hydroxybutyl)-1-piperidinecarboxylate