CAS 919496-59-6

[4-(Dimethylamino)-3-methylphenyl]boronic acid

Description:

[4-(Dimethylamino)-3-methylphenyl]boronic acid is an organic compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and is widely used in organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with a dimethylamino group and a methyl group, contributing to its unique electronic and steric properties. This structure enhances its reactivity and solubility in various solvents, making it suitable for applications in drug development and as a building block in the synthesis of complex organic molecules. The boronic acid moiety allows for participation in Suzuki coupling reactions, a key method for forming carbon-carbon bonds. Additionally, the compound's properties may include moderate stability under ambient conditions, but it may be sensitive to moisture and air, necessitating careful handling and storage. Overall, [4-(Dimethylamino)-3-methylphenyl]boronic acid is a valuable compound in the field of synthetic organic chemistry.

Formula: C₉H₁₄BNO₂

InChI: InChI=1S/C9H14BNO2/c1-7-6-8(10(12)13)4-5-9(7)11(2)3/h4-6,12-13H,1-3H3

SMILES: Cc1cc(ccc1N(C)C)B(O)O

Synonyms:

• 4-(N,N-Dimethylamino)-3-methylphenylboronic acid

(4-(Dimethylamino)-3-methylphenyl)boronic acid

CAS: 919496-59-6

Formula: C₉H₁₄BNO₂

Purity: 97%

Molecular weight: 179.024

Ref: IN-DA003SG7

4-(Dimethylamino)-3-methylbenzeneboronic acid

CAS: 919496-59-6

4-(Dimethylamino)-3-methylbenzeneboronic acid

Purity: ≥95%

Molecular weight: 179.02g/mol

Ref: 54-OR2764

4-(N,N-Dimethylamino)-3-methylphenylboronic acid

CAS: 919496-59-6

Purity: >96%

Molecular weight: 179.02

Ref: FT-T1658

N,N,2-Trimethylaniline-4-boronic acid

CAS: 919496-59-6

Versatile small molecule scaffold

Formula: C₉H₁₄BNO₂

Purity: Min. 95%

Molecular weight: 179.03 g/mol

Ref: 3D-ULB49659