CymitQuimica logo

CAS 919522-48-8

:

6-Chloro-N-(2-furanylmethyl)-3-pyridazinamine

Description:
6-Chloro-N-(2-furanylmethyl)-3-pyridazinamine is a chemical compound characterized by its unique structural features, which include a pyridazine ring and a furan moiety. The presence of a chlorine atom at the 6-position of the pyridazine contributes to its reactivity and potential biological activity. The furan group, known for its aromatic properties, enhances the compound's ability to participate in various chemical reactions. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it essential to consider these factors in experimental settings. Overall, 6-Chloro-N-(2-furanylmethyl)-3-pyridazinamine represents a class of compounds that may hold promise in drug development and other chemical applications.
Formula:C9H8ClN3O
InChI:InChI=1S/C9H8ClN3O/c10-8-3-4-9(13-12-8)11-6-7-2-1-5-14-7/h1-5H,6H2,(H,11,13)
InChI key:InChIKey=NTZYTEKCZDNYLZ-UHFFFAOYSA-N
SMILES:N(CC1=CC=CO1)C2=CC=C(Cl)N=N2
Synonyms:
  • 3-Pyridazinamine, 6-chloro-N-(2-furanylmethyl)-
  • 6-Chloro-N-(2-furanylmethyl)-3-pyridazinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.