CymitQuimica logo

CAS 91962-69-5

:

6,7,8,9-tetrahydrodibenzo[b,d]furan-4-ol

Description:
6,7,8,9-tetrahydrodibenzo[b,d]furan-4-ol is an organic compound characterized by its complex bicyclic structure, which includes a furan ring fused to two benzene rings. This compound features a hydroxyl (-OH) group at the 4-position of the dibenzofuran framework, contributing to its chemical reactivity and potential for hydrogen bonding. It is typically a colorless to pale yellow solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the hydroxyl group suggests that it may participate in various chemical reactions, including oxidation and esterification. Additionally, its structure may impart interesting biological properties, making it a subject of interest in medicinal chemistry. The compound's CAS number, 91962-69-5, allows for easy identification in chemical databases and literature. Overall, 6,7,8,9-tetrahydrodibenzo[b,d]furan-4-ol is notable for its unique structural features and potential applications in various fields of chemistry and pharmacology.
Formula:C12H12O2
InChI:InChI=1/C12H12O2/c13-10-6-3-5-9-8-4-1-2-7-11(8)14-12(9)10/h3,5-6,13H,1-2,4,7H2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.