CAS 91963-08-5
:(2E)-3-[2-(prop-2-en-1-yloxy)phenyl]prop-2-enoic acid
Description:
(2E)-3-[2-(prop-2-en-1-yloxy)phenyl]prop-2-enoic acid, also known by its CAS number 91963-08-5, is an organic compound characterized by its structure, which includes a phenyl group substituted with a prop-2-en-1-yloxy moiety and a prop-2-enoic acid functional group. This compound features a conjugated system due to the presence of double bonds in both the phenyl ether and the prop-2-enoic acid portions, which can contribute to its reactivity and potential applications in organic synthesis or as a building block in pharmaceuticals. The presence of the carboxylic acid group imparts acidic properties, allowing for potential interactions in biological systems or chemical reactions. Additionally, the compound's unsaturation may enhance its ability to participate in various chemical transformations, such as polymerization or cross-coupling reactions. Its unique structure suggests potential utility in materials science, medicinal chemistry, or as an intermediate in the synthesis of more complex molecules.
Formula:C12H12O3
InChI:InChI=1/C12H12O3/c1-2-9-15-11-6-4-3-5-10(11)7-8-12(13)14/h2-8H,1,9H2,(H,13,14)/b8-7+
Synonyms:- (2E)-3-[2-(Allyloxy)phenyl]acrylic acid
- 2-propenoic acid, 3-[2-(2-propen-1-yloxy)phenyl]-, (2E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.