CAS 91968-71-7
:2-Benzyloxy-2-methyl-1-propanol
Description:
2-Benzyloxy-2-methyl-1-propanol, with the CAS number 91968-71-7, is an organic compound characterized by its structure, which includes a benzyl ether and a tertiary alcohol. This compound typically appears as a colorless to pale yellow liquid and is known for its moderate solubility in water, along with better solubility in organic solvents such as ethanol and ether. The presence of the benzyl group contributes to its aromatic properties, while the hydroxyl group (-OH) imparts alcohol characteristics, making it a potential candidate for various chemical reactions, including esterification and etherification. Its molecular structure allows for hydrogen bonding, which can influence its physical properties, such as boiling point and viscosity. Additionally, 2-Benzyloxy-2-methyl-1-propanol may exhibit biological activity, making it of interest in pharmaceutical and chemical research. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C11H16O2
InChI:InChI=1/C11H16O2/c1-11(2,9-12)13-8-10-6-4-3-5-7-10/h3-7,12H,8-9H2,1-2H3
SMILES:CC(C)(CO)OCc1ccccc1
Synonyms:- 2-Benzyloxy-2-Methyl-Propan-1-Ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Benzyloxy-2-methyl-1-propanol, 95%
CAS:2-Benzyloxy-2-methyl-1-propanol is used as a building block in organic synthesis. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item cod
Formula:C11H16O2Purity:95%Color and Shape:Clear colorless to yellow, LiquidMolecular weight:180.122-Benzyloxy-2-methylpropan-1-ol
CAS:Formula:C11H16O2Purity:95%Color and Shape:SolidMolecular weight:180.24352-(Benzyloxy)-2-methylpropan-1-ol
CAS:2-(Benzyloxy)-2-methylpropan-1-olPurity:95%Molecular weight:180.24g/mol



