CAS 919738-05-9
:2-(2-pyridin-3-yl-1,3-thiazol-4-yl)ethanamine
Description:
2-(2-Pyridin-3-yl-1,3-thiazol-4-yl)ethanamine is a chemical compound characterized by its unique structural features, which include a pyridine ring and a thiazole moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate solubility in polar solvents and potential biological activity due to its ability to interact with various biological targets. The presence of the amino group suggests that it may participate in hydrogen bonding, enhancing its reactivity and potential as a pharmacophore in medicinal chemistry. Additionally, the thiazole and pyridine rings contribute to its electronic properties, which can influence its interaction with enzymes or receptors. This compound may be of interest in drug discovery and development, particularly in the context of targeting specific pathways in diseases. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be evaluated for its efficacy and safety in biological assays. Overall, 2-(2-pyridin-3-yl-1,3-thiazol-4-yl)ethanamine represents a class of compounds with potential applications in pharmaceuticals and biochemistry.
Formula:C10H11N3S
InChI:InChI=1/C10H11N3S/c11-4-3-9-7-14-10(13-9)8-2-1-5-12-6-8/h1-2,5-7H,3-4,11H2
SMILES:c1cc(cnc1)c1nc(CCN)cs1
Synonyms:- 4-Thiazoleethanamine, 2-(3-Pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
