CymitQuimica logo

CAS 919751-89-6

:

1-(2-ethyl-4-hydroxy-1,1-dioxo-benzo[e]thiazin-3-yl)ethanone

Description:
1-(2-ethyl-4-hydroxy-1,1-dioxo-benzo[e]thiazin-3-yl)ethanone, with the CAS number 919751-89-6, is a chemical compound that belongs to the class of thiazine derivatives. This substance is characterized by the presence of a benzo[e]thiazine core, which features a dioxo group and a hydroxy substituent, contributing to its potential biological activity. The ethyl group and the ethanone moiety enhance its lipophilicity, which may influence its solubility and interaction with biological membranes. The hydroxyl group can participate in hydrogen bonding, potentially affecting its reactivity and stability. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. However, detailed studies on its pharmacodynamics, toxicity, and therapeutic efficacy are essential for understanding its full potential and safety profile.
Formula:C12H13NO4S
InChI:InChI=1/C12H13NO4S/c1-3-13-11(8(2)14)12(15)9-6-4-5-7-10(9)18(13,16)17/h4-7,15H,3H2,1-2H3
SMILES:CCN1C(=C(c2ccccc2S1(=O)=O)O)C(=O)C
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.