CymitQuimica logo

CAS 919778-41-9

:

Phosphine, 1,1'-(1,2-phenylene)bis[1-(1,1-dimethylethyl)-1-methyl-

Description:
Phosphine, 1,1'-(1,2-phenylene)bis[1-(1,1-dimethylethyl)-1-methyl-] is a phosphine derivative characterized by its complex structure, which includes a phenylene group and bulky tert-butyl and methyl substituents. This compound typically exhibits properties associated with phosphines, such as being a colorless gas or liquid at room temperature, with a distinctive odor reminiscent of garlic or fish. It is generally less stable than simpler phosphines due to steric hindrance from the bulky substituents, which can affect its reactivity and interactions with other chemical species. The presence of the phenylene moiety may also impart unique electronic properties, influencing its behavior in coordination chemistry and catalysis. Additionally, phosphines are known to act as ligands in various metal complexes, and this particular compound may exhibit similar coordination capabilities. Safety considerations are important, as phosphines can be toxic and flammable, necessitating careful handling and storage. Overall, this compound represents a specialized class of phosphines with potential applications in organic synthesis and materials science.
Formula:C16H28P2
InChI:InChI=1S/C16H28P2/c1-15(2,3)17(7)13-11-9-10-12-14(13)18(8)16(4,5)6/h9-12H,1-8H3
InChI key:JFUWTGUCFKJVST-UHFFFAOYSA-N
SMILES:CC(C)(C)P(C)C1=CC=CC=C1P(C)C(C)(C)C
Found 6 products.