CAS 919778-41-9
:Phosphine, 1,1'-(1,2-phenylene)bis[1-(1,1-dimethylethyl)-1-methyl-
Description:
Phosphine, 1,1'-(1,2-phenylene)bis[1-(1,1-dimethylethyl)-1-methyl-] is a phosphine derivative characterized by its complex structure, which includes a phenylene group and bulky tert-butyl and methyl substituents. This compound typically exhibits properties associated with phosphines, such as being a colorless gas or liquid at room temperature, with a distinctive odor reminiscent of garlic or fish. It is generally less stable than simpler phosphines due to steric hindrance from the bulky substituents, which can affect its reactivity and interactions with other chemical species. The presence of the phenylene moiety may also impart unique electronic properties, influencing its behavior in coordination chemistry and catalysis. Additionally, phosphines are known to act as ligands in various metal complexes, and this particular compound may exhibit similar coordination capabilities. Safety considerations are important, as phosphines can be toxic and flammable, necessitating careful handling and storage. Overall, this compound represents a specialized class of phosphines with potential applications in organic synthesis and materials science.
Formula:C16H28P2
InChI:InChI=1S/C16H28P2/c1-15(2,3)17(7)13-11-9-10-12-14(13)18(8)16(4,5)6/h9-12H,1-8H3
InChI key:JFUWTGUCFKJVST-UHFFFAOYSA-N
SMILES:CC(C)(C)P(C)C1=CC=CC=C1P(C)C(C)(C)C
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
(R,R)-(+)-1,2-Bis(t-butylmethylphosphino)benzene (R,R)-BenzP*
CAS:(R,R)-(+)-1,2-Bis(t-butylmethylphosphino)benzene (R,R)-BenzP*
Formula:C16H28P2Color and Shape:white xtl.Molecular weight:282.34(R,R)-BenzP*
CAS:1,2-Bis((R)-tert-butyl(methyl)phosphino)benzeneFormula:C16H28P2Purity:98%Molecular weight:282.341,2-Bis((R)-tert-butyl(methyl)phosphino)benzene
CAS:Purity:97%Color and Shape:SolidMolecular weight:282.3479919(R,R)-(+)-1,2-Bis(t-butylmethylphosphino)benzene
CAS:(R,R)-(+)-1,2-Bis(t-butylmethylphosphino)benzene is an organophosphorus compound that is soluble in organic solvents. It is a ligand used in catalysis and as a reagent for organic synthesis. The compound is synthesized by reaction of phosphorus with benzene and t-butyl methyl chloride. The product can be purified by recrystallization or distillation. (R,R)-(+)-1,2-Bis(t-butylmethylphosphino)benzene reacts with methanol to produce methyl formate and water. It has been shown to be soluble in degassed solvents such as dichloromethane or chloroform.Formula:C16H28P2Purity:Min. 95%Molecular weight:282.34 g/mol1,2-Bis((R)-tert-butyl(methyl)phosphino)benzene
CAS:Formula:C16H28P2Purity:97%Color and Shape:SolidMolecular weight:282.3410Ref: IN-DA006559
Discontinued product





