CAS 919797-19-6
:4-Iodo-2,5-dimethoxy-N-[(2-methoxyphenyl)methyl]benzeneethanamine
Description:
4-Iodo-2,5-dimethoxy-N-[(2-methoxyphenyl)methyl]benzeneethanamine, identified by its CAS number 919797-19-6, is a synthetic organic compound that belongs to the class of phenethylamines. This compound features a complex structure characterized by the presence of an iodine atom, two methoxy groups, and a benzeneethanamine backbone. The methoxy groups contribute to its potential solubility and reactivity, while the iodine substituent may influence its electronic properties and biological activity. The compound's structure suggests it may interact with various biological targets, potentially exhibiting psychoactive effects similar to other phenethylamines. Its synthesis and characterization would typically involve standard organic chemistry techniques, including purification methods such as recrystallization or chromatography. Due to its structural complexity, it may also be of interest in medicinal chemistry and pharmacology, although specific biological data and applications would require further investigation. As with many synthetic compounds, safety and handling precautions are essential when working with this substance in a laboratory setting.
Formula:C18H22INO3
InChI:InChI=1S/C18H22INO3/c1-21-16-7-5-4-6-14(16)12-20-9-8-13-10-18(23-3)15(19)11-17(13)22-2/h4-7,10-11,20H,8-9,12H2,1-3H3
InChI key:InChIKey=ZFUOLNAKPBFDIJ-UHFFFAOYSA-N
SMILES:C(CNCC1=C(OC)C=CC=C1)C2=C(OC)C=C(I)C(OC)=C2
Synonyms:- Benzeneethanamine, 4-iodo-2,5-dimethoxy-N-[(2-methoxyphenyl)methyl]-
- 25I-NBOMe
- 2-(4-Iodo-2,5-dimethoxyphenyl)-N-[(2-methoxyphenyl)methyl]ethanamine
- 4-Iodo-2,5-dimethoxy-N-[(2-methoxyphenyl)methyl]benzeneethanamine
- 2C-I-NBOMe
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
