CAS 919836-24-1

4-Piperidinamine, 1-methyl-N-propyl-

Description:

4-Piperidinamine, 1-methyl-N-propyl- is an organic compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a primary amine functional group, contributing to its reactivity and potential applications in medicinal chemistry. The presence of a methyl group and a propyl group attached to the nitrogen atom enhances its lipophilicity, which may influence its pharmacokinetic properties. Typically, compounds like this can exhibit biological activity, making them of interest in drug development and synthesis. The molecular structure allows for various interactions with biological targets, potentially leading to therapeutic effects. As with many amines, it may also participate in hydrogen bonding, affecting its solubility and stability in different environments. Safety and handling precautions are essential, as amines can be hazardous and may require specific storage conditions to maintain their integrity. Overall, 4-Piperidinamine, 1-methyl-N-propyl- represents a class of compounds that are valuable in both research and industrial applications.

Formula: C₉H₂₀N₂

InChI: InChI=1S/C9H20N2/c1-3-6-10-9-4-7-11(2)8-5-9/h9-10H,3-8H2,1-2H3

InChI key: InChIKey=JLIXDTSZENGGOT-UHFFFAOYSA-N

SMILES: N(CCC)C1CCN(C)CC1

Synonyms:

• N-(1-Methylpiperidin-4-yl)propylamine
• 4-Piperidinamine, 1-methyl-N-propyl-
• 1-Methyl-N-propylpiperidin-4-amine