
CAS 91996-77-9
:Pyrido[2,3-d]pyrimidin-2(1H)-one
Description:
Pyrido[2,3-d]pyrimidin-2(1H)-one is a heterocyclic organic compound characterized by a fused ring system that incorporates both pyridine and pyrimidine structures. This compound features a nitrogen-containing bicyclic framework, which contributes to its potential biological activity and chemical reactivity. It typically exhibits a solid state at room temperature and is soluble in polar organic solvents. The presence of nitrogen atoms in its structure can influence its acidity and basicity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Pyrido[2,3-d]pyrimidin-2(1H)-one has garnered interest in medicinal chemistry due to its potential as a scaffold for drug development, particularly in targeting specific biological pathways. Its unique structural characteristics may also allow for the exploration of derivatives with enhanced pharmacological properties. As with many heterocycles, the compound's reactivity and interactions can be influenced by substituents on the ring, making it a versatile compound in synthetic organic chemistry.
Formula:C7H5N3O
InChI:InChI=1S/C7H5N3O/c11-7-9-4-5-2-1-3-8-6(5)10-7/h1-4H,(H,8,9,10,11)
InChI key:InChIKey=MHHOMHMNIRXARC-UHFFFAOYSA-N
SMILES:O=C1NC=2C(C=N1)=CC=CN2
Synonyms:- 1H,2H-Pyrido[2,3-d]pyrimidin-2-one
- Pyrido[2,3-d]pyrimidin-2(1H)-one
- Pyrido[2,3-d]pyrimidin-2-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.