CAS 919995-27-0
:1-(4-methoxy-3-(3-methoxypropoxy)phenyl)-3-methylbutan-1-one
Description:
1-(4-methoxy-3-(3-methoxypropoxy)phenyl)-3-methylbutan-1-one, with the CAS number 919995-27-0, is a synthetic organic compound characterized by its complex molecular structure, which includes a phenyl ring substituted with methoxy and propoxy groups. This compound typically exhibits properties associated with ketones, such as being a liquid at room temperature and having a distinct odor. Its methoxy groups contribute to its solubility in organic solvents, while the presence of the butanone moiety suggests potential reactivity typical of ketones, including nucleophilic addition reactions. The compound may also exhibit biological activity, making it of interest in pharmaceutical and chemical research. However, specific data regarding its melting point, boiling point, and other physical properties would require empirical measurement or detailed literature references. As with many synthetic compounds, safety data sheets should be consulted for handling and toxicity information.
Formula:C16H24O4
InChI:InChI=1/C16H24O4/c1-12(2)10-14(17)13-6-7-15(19-4)16(11-13)20-9-5-8-18-3/h6-7,11-12H,5,8-10H2,1-4H3
SMILES:CC(C)CC(=O)c1ccc(c(c1)OCCCOC)OC
Synonyms:- 1-(4-Methoxy-3-(3-Methoxypropoxy)Phenyl)-3-Methyl-Butan-1-One
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(4-Methoxy-3-(3-methoxypropoxy)phenyl)-3-methylbutan-1-one
CAS:Formula:C16H24O4Molecular weight:280.3594
